C21H44N2O4 — CID 160774026
3-butoxy-N,N-diethylpropanamide;N,N-diethyl-3-propan-2-yloxypropanamide (PubChem CID 160774026) has the molecular formula C21H44N2O4 and a molecular weight of 388.59 g/mol. Its IUPAC name is 3-butoxy-N,N-diethylpropanamide;N,N-diethyl-3-propan-2-yloxypropanamide.
| Compound Name | 3-butoxy-N,N-diethylpropanamide;N,N-diethyl-3-propan-2-yloxypropanamide |
|---|---|
| PubChem CID | 160774026 |
| Molecular Formula | C21H44N2O4 |
| Molecular Weight | 388.59 g/mol |
| Exact Mass | 388.33 |
| IUPAC Name | 3-butoxy-N,N-diethylpropanamide;N,N-diethyl-3-propan-2-yloxypropanamide |
| SMILES | CCCCOCCC(=O)N(CC)CC.CCN(CC)C(=O)CCOC(C)C |
| InChI | InChI=1S/C11H23NO2.C10H21NO2/c1-4-7-9-14-10-8-11(13)12(5-2)6-3;1-5-11(6-2)10(12)7-8-13-9(3)4/h4-10H2,1-3H3;9H,5-8H2,1-4H3 |
| InChIKey | RZRWTBPDKRHUKV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.59 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|