C15H32N2O4 — CID 141458250
3-butoxy-N,N-dimethylpropanamide;3-methoxy-N,N-dimethylpropanamide (PubChem CID 141458250) has the molecular formula C15H32N2O4 and a molecular weight of 304.43 g/mol. Its IUPAC name is 3-butoxy-N,N-dimethylpropanamide;3-methoxy-N,N-dimethylpropanamide.
| Compound Name | 3-butoxy-N,N-dimethylpropanamide;3-methoxy-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 141458250 |
| Molecular Formula | C15H32N2O4 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 3-butoxy-N,N-dimethylpropanamide;3-methoxy-N,N-dimethylpropanamide |
| SMILES | CCCCOCCC(=O)N(C)C.COCCC(=O)N(C)C |
| InChI | InChI=1S/C9H19NO2.C6H13NO2/c1-4-5-7-12-8-6-9(11)10(2)3;1-7(2)6(8)4-5-9-3/h4-8H2,1-3H3;4-5H2,1-3H3 |
| InChIKey | XWOMNYABVTZBIM-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|