C12H26N2O4 — CID 159478663
3-methoxy-N,N-dimethylpropanamide (PubChem CID 159478663) has the molecular formula C12H26N2O4 and a molecular weight of 262.35 g/mol. Its IUPAC name is 3-methoxy-N,N-dimethylpropanamide.
| Compound Name | 3-methoxy-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 159478663 |
| Molecular Formula | C12H26N2O4 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 3-methoxy-N,N-dimethylpropanamide |
| SMILES | COCCC(=O)N(C)C.COCCC(=O)N(C)C |
| InChI | InChI=1S/2C6H13NO2/c2*1-7(2)6(8)4-5-9-3/h2*4-5H2,1-3H3 |
| InChIKey | LWSFBUNAPAZSNP-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |