About N,N-diethyloctadecanamide;propan-1-amine;hydrobromide
N,N-diethyloctadecanamide;propan-1-amine;hydrobromide (PubChem CID 174816877) has the molecular formula C25H55BrN2O
and a molecular weight of 479.63 g/mol. Its IUPAC name is N,N-diethyloctadecanamide;propan-1-amine;hydrobromide.
Molecular Properties
| Compound Name | N,N-diethyloctadecanamide;propan-1-amine;hydrobromide |
| PubChem CID | 174816877 |
| Molecular Formula | C25H55BrN2O |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 478.35 |
| IUPAC Name | N,N-diethyloctadecanamide;propan-1-amine;hydrobromide |
| SMILES | Br.CCCCCCCCCCCCCCCCCC(=O)N(CC)CC.CCCN |
| InChI | InChI=1S/C22H45NO.C3H9N.BrH/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(24)23(5-2)6-3;1-2-3-4;/h4-21H2,1-3H3;2-4H2,1H3;1H |
| InChIKey | RAKMXHUWAVVZEQ-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethyloctadecanamide;propan-1-amine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyloctadecanamide;propan-1-amine;hydrobromide?
The IUPAC name of N,N-diethyloctadecanamide;propan-1-amine;hydrobromide (CID 174816877) is N,N-diethyloctadecanamide;propan-1-amine;hydrobromide.
What is the SMILES notation for N,N-diethyloctadecanamide;propan-1-amine;hydrobromide?
The canonical SMILES for N,N-diethyloctadecanamide;propan-1-amine;hydrobromide is Br.CCCCCCCCCCCCCCCCCC(=O)N(CC)CC.CCCN.
What is the InChIKey of N,N-diethyloctadecanamide;propan-1-amine;hydrobromide?
The InChIKey is RAKMXHUWAVVZEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H45NO.C3H9N.BrH/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(24)23(5-2)6-3;1-2-3-4;/h4-21H2,1-3H3;2-4H2,1H3;1H.
What are the key properties of N,N-diethyloctadecanamide;propan-1-amine;hydrobromide?
N,N-diethyloctadecanamide;propan-1-amine;hydrobromide has a molecular weight of 479.63 g/mol, XLogP of 8.05, 19 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyloctadecanamide;propan-1-amine;hydrobromide is sourced from PubChem (CID 174816877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).