C13H29NO3 — CID 63698274
3,3-diethoxy-N-(2-ethoxyethyl)-N-ethylpropan-1-amine (PubChem CID 63698274) has the molecular formula C13H29NO3 and a molecular weight of 247.38 g/mol. Its IUPAC name is 3,3-diethoxy-N-(2-ethoxyethyl)-N-ethylpropan-1-amine.
| Compound Name | 3,3-diethoxy-N-(2-ethoxyethyl)-N-ethylpropan-1-amine |
|---|---|
| PubChem CID | 63698274 |
| Molecular Formula | C13H29NO3 |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.21 |
| IUPAC Name | 3,3-diethoxy-N-(2-ethoxyethyl)-N-ethylpropan-1-amine |
| SMILES | CCOCCN(CC)CCC(OCC)OCC |
| InChI | InChI=1S/C13H29NO3/c1-5-14(11-12-15-6-2)10-9-13(16-7-3)17-8-4/h13H,5-12H2,1-4H3 |
| InChIKey | NICNMBSYGNRGOJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|