C15H33NO2 — CID 55247243
N-(3,3-diethoxypropyl)-N,2-diethylbutan-1-amine (PubChem CID 55247243) has the molecular formula C15H33NO2 and a molecular weight of 259.43 g/mol. Its IUPAC name is N-(3,3-diethoxypropyl)-N,2-diethylbutan-1-amine.
| Compound Name | N-(3,3-diethoxypropyl)-N,2-diethylbutan-1-amine |
|---|---|
| PubChem CID | 55247243 |
| Molecular Formula | C15H33NO2 |
| Molecular Weight | 259.43 g/mol |
| Exact Mass | 259.25 |
| IUPAC Name | N-(3,3-diethoxypropyl)-N,2-diethylbutan-1-amine |
| SMILES | CCOC(CCN(CC)CC(CC)CC)OCC |
| InChI | InChI=1S/C15H33NO2/c1-6-14(7-2)13-16(8-3)12-11-15(17-9-4)18-10-5/h14-15H,6-13H2,1-5H3 |
| InChIKey | BZLYZSJDHRIGDS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|