C16H39N — CID 145001247
ethane;2-ethyl-N,N-dipropylbutan-1-amine (PubChem CID 145001247) has the molecular formula C16H39N and a molecular weight of 245.49 g/mol. Its IUPAC name is ethane;2-ethyl-N,N-dipropylbutan-1-amine.
| Compound Name | ethane;2-ethyl-N,N-dipropylbutan-1-amine |
|---|---|
| PubChem CID | 145001247 |
| Molecular Formula | C16H39N |
| Molecular Weight | 245.49 g/mol |
| Exact Mass | 245.31 |
| IUPAC Name | ethane;2-ethyl-N,N-dipropylbutan-1-amine |
| SMILES | CC.CC.CCCN(CCC)CC(CC)CC |
| InChI | InChI=1S/C12H27N.2C2H6/c1-5-9-13(10-6-2)11-12(7-3)8-4;2*1-2/h12H,5-11H2,1-4H3;2*1-2H3 |
| InChIKey | PFMRIIQPDQIBEC-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.49 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |