C14H31ClN2 — CID 91186850
1-chloro-N,N,N',N'-tetrapropylethane-1,2-diamine (PubChem CID 91186850) has the molecular formula C14H31ClN2 and a molecular weight of 262.87 g/mol. Its IUPAC name is 1-chloro-N,N,N',N'-tetrapropylethane-1,2-diamine.
| Compound Name | 1-chloro-N,N,N',N'-tetrapropylethane-1,2-diamine |
|---|---|
| PubChem CID | 91186850 |
| Molecular Formula | C14H31ClN2 |
| Molecular Weight | 262.87 g/mol |
| Exact Mass | 262.22 |
| IUPAC Name | 1-chloro-N,N,N',N'-tetrapropylethane-1,2-diamine |
| SMILES | CCCN(CCC)CC(Cl)N(CCC)CCC |
| InChI | InChI=1S/C14H31ClN2/c1-5-9-16(10-6-2)13-14(15)17(11-7-3)12-8-4/h14H,5-13H2,1-4H3 |
| InChIKey | UDBKASUIVYKUTA-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.87 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|