C10H23N — CID 524229
N,N-dipropylbutan-2-amine (PubChem CID 524229) has the molecular formula C10H23N and a molecular weight of 157.30 g/mol. Its IUPAC name is N,N-dipropylbutan-2-amine.
| Compound Name | N,N-dipropylbutan-2-amine |
|---|---|
| PubChem CID | 524229 |
| Molecular Formula | C10H23N |
| Molecular Weight | 157.30 g/mol |
| Exact Mass | 157.18 |
| IUPAC Name | N,N-dipropylbutan-2-amine |
| SMILES | CCCN(CCC)C(C)CC |
| InChI | InChI=1S/C10H23N/c1-5-8-11(9-6-2)10(4)7-3/h10H,5-9H2,1-4H3 |
| InChIKey | NSZRJEQFXFOQPL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |