C13H32N2Si — CID 174173151
N,N,N',N'-tetrapropyl-1-silylmethanediamine (PubChem CID 174173151) has the molecular formula C13H32N2Si and a molecular weight of 244.50 g/mol. Its IUPAC name is N,N,N',N'-tetrapropyl-1-silylmethanediamine.
| Compound Name | N,N,N',N'-tetrapropyl-1-silylmethanediamine |
|---|---|
| PubChem CID | 174173151 |
| Molecular Formula | C13H32N2Si |
| Molecular Weight | 244.50 g/mol |
| Exact Mass | 244.23 |
| IUPAC Name | N,N,N',N'-tetrapropyl-1-silylmethanediamine |
| SMILES | CCCN(CCC)C([SiH3])N(CCC)CCC |
| InChI | InChI=1S/C13H32N2Si/c1-5-9-14(10-6-2)13(16)15(11-7-3)12-8-4/h13H,5-12H2,1-4,16H3 |
| InChIKey | BBKJUELTQZMNJQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.50 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|