C19H49N — CID 143577846
N,N-dipropylbutan-2-amine;ethane;propane (PubChem CID 143577846) has the molecular formula C19H49N and a molecular weight of 291.61 g/mol. Its IUPAC name is N,N-dipropylbutan-2-amine;ethane;propane.
| Compound Name | N,N-dipropylbutan-2-amine;ethane;propane |
|---|---|
| PubChem CID | 143577846 |
| Molecular Formula | C19H49N |
| Molecular Weight | 291.61 g/mol |
| Exact Mass | 291.39 |
| IUPAC Name | N,N-dipropylbutan-2-amine;ethane;propane |
| SMILES | CC.CC.CC.CCC.CCCN(CCC)C(C)CC |
| InChI | InChI=1S/C10H23N.C3H8.3C2H6/c1-5-8-11(9-6-2)10(4)7-3;1-3-2;3*1-2/h10H,5-9H2,1-4H3;3H2,1-2H3;3*1-2H3 |
| InChIKey | AHKVRSGCPHYBHT-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.61 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |