C11H23N — CID 121218071
(E)-N,N-dipropylpent-3-en-2-amine (PubChem CID 121218071) has the molecular formula C11H23N and a molecular weight of 169.31 g/mol. Its IUPAC name is (E)-N,N-dipropylpent-3-en-2-amine.
| Compound Name | (E)-N,N-dipropylpent-3-en-2-amine |
|---|---|
| PubChem CID | 121218071 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | (E)-N,N-dipropylpent-3-en-2-amine |
| SMILES | C/C=C/C(C)N(CCC)CCC |
| InChI | InChI=1S/C11H23N/c1-5-8-11(4)12(9-6-2)10-7-3/h5,8,11H,6-7,9-10H2,1-4H3/b8-5+ |
| InChIKey | JUEBRSVKSSPOHM-VMPITWQZSA-N |
| XLogP | 3.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|