C11H24ClN — CID 155653024
N,N-dipropylpent-3-en-2-amine;hydrochloride (PubChem CID 155653024) has the molecular formula C11H24ClN and a molecular weight of 205.77 g/mol. Its IUPAC name is N,N-dipropylpent-3-en-2-amine;hydrochloride.
| Compound Name | N,N-dipropylpent-3-en-2-amine;hydrochloride |
|---|---|
| PubChem CID | 155653024 |
| Molecular Formula | C11H24ClN |
| Molecular Weight | 205.77 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | N,N-dipropylpent-3-en-2-amine;hydrochloride |
| SMILES | CC=CC(C)N(CCC)CCC.Cl |
| InChI | InChI=1S/C11H23N.ClH/c1-5-8-11(4)12(9-6-2)10-7-3;/h5,8,11H,6-7,9-10H2,1-4H3;1H |
| InChIKey | HFXFWPPBUGKIEG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.77 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|