About (E)-4-methylicos-2-ene
(E)-4-methylicos-2-ene (PubChem CID 166512402) has the molecular formula C21H42
and a molecular weight of 294.57 g/mol. Its IUPAC name is (E)-4-methylicos-2-ene.
Molecular Properties
| Compound Name | (E)-4-methylicos-2-ene |
| PubChem CID | 166512402 |
| Molecular Formula | C21H42 |
| Molecular Weight | 294.57 g/mol |
| Exact Mass | 294.33 |
| IUPAC Name | (E)-4-methylicos-2-ene |
| SMILES | C/C=C/C(C)CCCCCCCCCCCCCCCC |
| InChI | InChI=1S/C21H42/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-20-21(3)19-5-2/h5,19,21H,4,6-18,20H2,1-3H3/b19-5+ |
| InChIKey | BMEZPCUIROSREN-PTXOJBNSSA-N |
| XLogP | 8.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.57 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-methylicos-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-methylicos-2-ene?
The IUPAC name of (E)-4-methylicos-2-ene (CID 166512402) is (E)-4-methylicos-2-ene.
What is the SMILES notation for (E)-4-methylicos-2-ene?
The canonical SMILES for (E)-4-methylicos-2-ene is C/C=C/C(C)CCCCCCCCCCCCCCCC.
What is the InChIKey of (E)-4-methylicos-2-ene?
The InChIKey is BMEZPCUIROSREN-PTXOJBNSSA-N. The full InChI is InChI=1S/C21H42/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-20-21(3)19-5-2/h5,19,21H,4,6-18,20H2,1-3H3/b19-5+.
What are the key properties of (E)-4-methylicos-2-ene?
(E)-4-methylicos-2-ene has a molecular weight of 294.57 g/mol, XLogP of 8.07, 16 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-methylicos-2-ene is sourced from PubChem (CID 166512402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).