About 7-methylhexadec-5-ene
7-methylhexadec-5-ene (PubChem CID 150059561) has the molecular formula C17H34
and a molecular weight of 238.46 g/mol. Its IUPAC name is 7-methylhexadec-5-ene.
Molecular Properties
| Compound Name | 7-methylhexadec-5-ene |
| PubChem CID | 150059561 |
| Molecular Formula | C17H34 |
| Molecular Weight | 238.46 g/mol |
| Exact Mass | 238.27 |
| IUPAC Name | 7-methylhexadec-5-ene |
| SMILES | CCCCC=CC(C)CCCCCCCCC |
| InChI | InChI=1S/C17H34/c1-4-6-8-10-11-12-14-16-17(3)15-13-9-7-5-2/h13,15,17H,4-12,14,16H2,1-3H3 |
| InChIKey | DMZVAHRTAMMFJA-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 238.46 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-methylhexadec-5-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methylhexadec-5-ene?
The IUPAC name of 7-methylhexadec-5-ene (CID 150059561) is 7-methylhexadec-5-ene.
What is the SMILES notation for 7-methylhexadec-5-ene?
The canonical SMILES for 7-methylhexadec-5-ene is CCCCC=CC(C)CCCCCCCCC.
What is the InChIKey of 7-methylhexadec-5-ene?
The InChIKey is DMZVAHRTAMMFJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34/c1-4-6-8-10-11-12-14-16-17(3)15-13-9-7-5-2/h13,15,17H,4-12,14,16H2,1-3H3.
What are the key properties of 7-methylhexadec-5-ene?
7-methylhexadec-5-ene has a molecular weight of 238.46 g/mol, XLogP of 6.51, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methylhexadec-5-ene is sourced from PubChem (CID 150059561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).