About 5,10-dimethylhexadec-8-ene
5,10-dimethylhexadec-8-ene (PubChem CID 91557751) has the molecular formula C18H36
and a molecular weight of 252.49 g/mol. Its IUPAC name is 5,10-dimethylhexadec-8-ene.
Molecular Properties
| Compound Name | 5,10-dimethylhexadec-8-ene |
| PubChem CID | 91557751 |
| Molecular Formula | C18H36 |
| Molecular Weight | 252.49 g/mol |
| Exact Mass | 252.28 |
| IUPAC Name | 5,10-dimethylhexadec-8-ene |
| SMILES | CCCCCCC(C)C=CCCC(C)CCCC |
| InChI | InChI=1S/C18H36/c1-5-7-9-10-14-18(4)16-12-11-15-17(3)13-8-6-2/h12,16-18H,5-11,13-15H2,1-4H3 |
| InChIKey | QSKUOPSSMBYQOK-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 252.49 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5,10-dimethylhexadec-8-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,10-dimethylhexadec-8-ene?
The IUPAC name of 5,10-dimethylhexadec-8-ene (CID 91557751) is 5,10-dimethylhexadec-8-ene.
What is the SMILES notation for 5,10-dimethylhexadec-8-ene?
The canonical SMILES for 5,10-dimethylhexadec-8-ene is CCCCCCC(C)C=CCCC(C)CCCC.
What is the InChIKey of 5,10-dimethylhexadec-8-ene?
The InChIKey is QSKUOPSSMBYQOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36/c1-5-7-9-10-14-18(4)16-12-11-15-17(3)13-8-6-2/h12,16-18H,5-11,13-15H2,1-4H3.
What are the key properties of 5,10-dimethylhexadec-8-ene?
5,10-dimethylhexadec-8-ene has a molecular weight of 252.49 g/mol, XLogP of 6.76, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5,10-dimethylhexadec-8-ene is sourced from PubChem (CID 91557751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).