C19H38 — CID 173194605
(E)-5,11-dimethylheptadec-8-ene (PubChem CID 173194605) has the molecular formula C19H38 and a molecular weight of 266.51 g/mol. Its IUPAC name is (E)-5,11-dimethylheptadec-8-ene.
| Compound Name | (E)-5,11-dimethylheptadec-8-ene |
|---|---|
| PubChem CID | 173194605 |
| Molecular Formula | C19H38 |
| Molecular Weight | 266.51 g/mol |
| Exact Mass | 266.30 |
| IUPAC Name | (E)-5,11-dimethylheptadec-8-ene |
| SMILES | CCCCCCC(C)C/C=C/CCC(C)CCCC |
| InChI | InChI=1S/C19H38/c1-5-7-9-11-15-19(4)17-13-10-12-16-18(3)14-8-6-2/h10,13,18-19H,5-9,11-12,14-17H2,1-4H3/b13-10+ |
| InChIKey | RONBHDHQXJRSEZ-JLHYYAGUSA-N |
| XLogP | 7.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.51 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|