C26H52 — CID 123705440
9,16-dimethyltetracos-11-ene (PubChem CID 123705440) has the molecular formula C26H52 and a molecular weight of 364.70 g/mol. Its IUPAC name is 9,16-dimethyltetracos-11-ene.
| Compound Name | 9,16-dimethyltetracos-11-ene |
|---|---|
| PubChem CID | 123705440 |
| Molecular Formula | C26H52 |
| Molecular Weight | 364.70 g/mol |
| Exact Mass | 364.41 |
| IUPAC Name | 9,16-dimethyltetracos-11-ene |
| SMILES | CCCCCCCCC(C)CC=CCCCC(C)CCCCCCCC |
| InChI | InChI=1S/C26H52/c1-5-7-9-11-13-17-21-25(3)23-19-15-16-20-24-26(4)22-18-14-12-10-8-6-2/h15,19,25-26H,5-14,16-18,20-24H2,1-4H3 |
| InChIKey | GVJMCDUAOMAVRS-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 20 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.70 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|