About (E)-4,9-dimethyltetradec-6-ene
(E)-4,9-dimethyltetradec-6-ene (PubChem CID 173273385) has the molecular formula C16H32
and a molecular weight of 224.43 g/mol. Its IUPAC name is (E)-4,9-dimethyltetradec-6-ene.
Molecular Properties
| Compound Name | (E)-4,9-dimethyltetradec-6-ene |
| PubChem CID | 173273385 |
| Molecular Formula | C16H32 |
| Molecular Weight | 224.43 g/mol |
| Exact Mass | 224.25 |
| IUPAC Name | (E)-4,9-dimethyltetradec-6-ene |
| SMILES | CCCCCC(C)C/C=C/CC(C)CCC |
| InChI | InChI=1S/C16H32/c1-5-7-8-12-16(4)14-10-9-13-15(3)11-6-2/h9-10,15-16H,5-8,11-14H2,1-4H3/b10-9+ |
| InChIKey | GDYALFWQUDRXKK-MDZDMXLPSA-N |
| XLogP | 5.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 224.43 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-4,9-dimethyltetradec-6-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4,9-dimethyltetradec-6-ene?
The IUPAC name of (E)-4,9-dimethyltetradec-6-ene (CID 173273385) is (E)-4,9-dimethyltetradec-6-ene.
What is the SMILES notation for (E)-4,9-dimethyltetradec-6-ene?
The canonical SMILES for (E)-4,9-dimethyltetradec-6-ene is CCCCCC(C)C/C=C/CC(C)CCC.
What is the InChIKey of (E)-4,9-dimethyltetradec-6-ene?
The InChIKey is GDYALFWQUDRXKK-MDZDMXLPSA-N. The full InChI is InChI=1S/C16H32/c1-5-7-8-12-16(4)14-10-9-13-15(3)11-6-2/h9-10,15-16H,5-8,11-14H2,1-4H3/b10-9+.
What are the key properties of (E)-4,9-dimethyltetradec-6-ene?
(E)-4,9-dimethyltetradec-6-ene has a molecular weight of 224.43 g/mol, XLogP of 5.98, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4,9-dimethyltetradec-6-ene is sourced from PubChem (CID 173273385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).