C22H42 — CID 175445271
(6E,15E)-11-methylhenicosa-6,15-diene (PubChem CID 175445271) has the molecular formula C22H42 and a molecular weight of 306.58 g/mol. Its IUPAC name is (6E,15E)-11-methylhenicosa-6,15-diene.
| Compound Name | (6E,15E)-11-methylhenicosa-6,15-diene |
|---|---|
| PubChem CID | 175445271 |
| Molecular Formula | C22H42 |
| Molecular Weight | 306.58 g/mol |
| Exact Mass | 306.33 |
| IUPAC Name | (6E,15E)-11-methylhenicosa-6,15-diene |
| SMILES | CCCCC/C=C/CCCC(C)CCC/C=C/CCCCC |
| InChI | InChI=1S/C22H42/c1-4-6-8-10-12-14-16-18-20-22(3)21-19-17-15-13-11-9-7-5-2/h12-15,22H,4-11,16-21H2,1-3H3/b14-12+,15-13+ |
| InChIKey | SNGKZNNYFUDRAF-QUMQEAAQSA-N |
| XLogP | 8.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.58 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|