C25H50 — CID 173194599
(E)-10,15-dimethyltricos-3-ene (PubChem CID 173194599) has the molecular formula C25H50 and a molecular weight of 350.68 g/mol. Its IUPAC name is (E)-10,15-dimethyltricos-3-ene.
| Compound Name | (E)-10,15-dimethyltricos-3-ene |
|---|---|
| PubChem CID | 173194599 |
| Molecular Formula | C25H50 |
| Molecular Weight | 350.68 g/mol |
| Exact Mass | 350.39 |
| IUPAC Name | (E)-10,15-dimethyltricos-3-ene |
| SMILES | CC/C=C/CCCCCC(C)CCCCC(C)CCCCCCCC |
| InChI | InChI=1S/C25H50/c1-5-7-9-11-13-15-17-21-25(4)23-19-18-22-24(3)20-16-14-12-10-8-6-2/h7,9,24-25H,5-6,8,10-23H2,1-4H3/b9-7+ |
| InChIKey | VMLJDFBFHWORAL-VQHVLOKHSA-N |
| XLogP | 9.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 19 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.68 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|