About 5-prop-1-enyltridecane
5-prop-1-enyltridecane (PubChem CID 57064303) has the molecular formula C16H32
and a molecular weight of 224.43 g/mol. Its IUPAC name is 5-prop-1-enyltridecane.
Molecular Properties
| Compound Name | 5-prop-1-enyltridecane |
| PubChem CID | 57064303 |
| Molecular Formula | C16H32 |
| Molecular Weight | 224.43 g/mol |
| Exact Mass | 224.25 |
| IUPAC Name | 5-prop-1-enyltridecane |
| SMILES | CC=CC(CCCC)CCCCCCCC |
| InChI | InChI=1S/C16H32/c1-4-7-9-10-11-12-15-16(13-6-3)14-8-5-2/h6,13,16H,4-5,7-12,14-15H2,1-3H3 |
| InChIKey | HVNYVLWWBSNJAE-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 224.43 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-prop-1-enyltridecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-prop-1-enyltridecane?
The IUPAC name of 5-prop-1-enyltridecane (CID 57064303) is 5-prop-1-enyltridecane.
What is the SMILES notation for 5-prop-1-enyltridecane?
The canonical SMILES for 5-prop-1-enyltridecane is CC=CC(CCCC)CCCCCCCC.
What is the InChIKey of 5-prop-1-enyltridecane?
The InChIKey is HVNYVLWWBSNJAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32/c1-4-7-9-10-11-12-15-16(13-6-3)14-8-5-2/h6,13,16H,4-5,7-12,14-15H2,1-3H3.
What are the key properties of 5-prop-1-enyltridecane?
5-prop-1-enyltridecane has a molecular weight of 224.43 g/mol, XLogP of 6.12, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-prop-1-enyltridecane is sourced from PubChem (CID 57064303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).