About propane;(E)-5-[(Z)-prop-1-enyl]non-2-ene
propane;(E)-5-[(Z)-prop-1-enyl]non-2-ene (PubChem CID 143978428) has the molecular formula C15H30
and a molecular weight of 210.40 g/mol. Its IUPAC name is propane;(E)-5-[(Z)-prop-1-enyl]non-2-ene.
Molecular Properties
| Compound Name | propane;(E)-5-[(Z)-prop-1-enyl]non-2-ene |
| PubChem CID | 143978428 |
| Molecular Formula | C15H30 |
| Molecular Weight | 210.40 g/mol |
| Exact Mass | 210.23 |
| IUPAC Name | propane;(E)-5-[(Z)-prop-1-enyl]non-2-ene |
| SMILES | C/C=C\C(C/C=C/C)CCCC.CCC |
| InChI | InChI=1S/C12H22.C3H8/c1-4-7-10-12(9-6-3)11-8-5-2;1-3-2/h4,6-7,9,12H,5,8,10-11H2,1-3H3;3H2,1-2H3/b7-4+,9-6-; |
| InChIKey | RCYQZDXOUYDCCC-TYUNJGNJSA-N |
| XLogP | 5.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 210.40 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze propane;(E)-5-[(Z)-prop-1-enyl]non-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane;(E)-5-[(Z)-prop-1-enyl]non-2-ene?
The IUPAC name of propane;(E)-5-[(Z)-prop-1-enyl]non-2-ene (CID 143978428) is propane;(E)-5-[(Z)-prop-1-enyl]non-2-ene.
What is the SMILES notation for propane;(E)-5-[(Z)-prop-1-enyl]non-2-ene?
The canonical SMILES for propane;(E)-5-[(Z)-prop-1-enyl]non-2-ene is C/C=C\C(C/C=C/C)CCCC.CCC.
What is the InChIKey of propane;(E)-5-[(Z)-prop-1-enyl]non-2-ene?
The InChIKey is RCYQZDXOUYDCCC-TYUNJGNJSA-N. The full InChI is InChI=1S/C12H22.C3H8/c1-4-7-10-12(9-6-3)11-8-5-2;1-3-2/h4,6-7,9,12H,5,8,10-11H2,1-3H3;3H2,1-2H3/b7-4+,9-6-;.
What are the key properties of propane;(E)-5-[(Z)-prop-1-enyl]non-2-ene?
propane;(E)-5-[(Z)-prop-1-enyl]non-2-ene has a molecular weight of 210.40 g/mol, XLogP of 5.75, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for propane;(E)-5-[(Z)-prop-1-enyl]non-2-ene is sourced from PubChem (CID 143978428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).