C14H26 — CID 91185821
7-ethyl-4-methylundeca-2,5-diene (PubChem CID 91185821) has the molecular formula C14H26 and a molecular weight of 194.36 g/mol. Its IUPAC name is 7-ethyl-4-methylundeca-2,5-diene.
| Compound Name | 7-ethyl-4-methylundeca-2,5-diene |
|---|---|
| PubChem CID | 91185821 |
| Molecular Formula | C14H26 |
| Molecular Weight | 194.36 g/mol |
| Exact Mass | 194.20 |
| IUPAC Name | 7-ethyl-4-methylundeca-2,5-diene |
| SMILES | CC=CC(C)C=CC(CC)CCCC |
| InChI | InChI=1S/C14H26/c1-5-8-10-14(7-3)12-11-13(4)9-6-2/h6,9,11-14H,5,7-8,10H2,1-4H3 |
| InChIKey | FFTJGJHPAIJFSI-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.36 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|