About 2-ethylhexanal;methane
2-ethylhexanal;methane (PubChem CID 139299505) has the molecular formula C9H20O
and a molecular weight of 144.26 g/mol. Its IUPAC name is 2-ethylhexanal;methane.
Molecular Properties
| Compound Name | 2-ethylhexanal;methane |
| PubChem CID | 139299505 |
| Molecular Formula | C9H20O |
| Molecular Weight | 144.26 g/mol |
| Exact Mass | 144.15 |
| IUPAC Name | 2-ethylhexanal;methane |
| SMILES | C.CCCCC(C=O)CC |
| InChI | InChI=1S/C8H16O.CH4/c1-3-5-6-8(4-2)7-9;/h7-8H,3-6H2,1-2H3;1H4 |
| InChIKey | GAICMXQYGSUMGC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.26 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylhexanal;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexanal;methane?
The IUPAC name of 2-ethylhexanal;methane (CID 139299505) is 2-ethylhexanal;methane.
What is the SMILES notation for 2-ethylhexanal;methane?
The canonical SMILES for 2-ethylhexanal;methane is C.CCCCC(C=O)CC.
What is the InChIKey of 2-ethylhexanal;methane?
The InChIKey is GAICMXQYGSUMGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O.CH4/c1-3-5-6-8(4-2)7-9;/h7-8H,3-6H2,1-2H3;1H4.
What are the key properties of 2-ethylhexanal;methane?
2-ethylhexanal;methane has a molecular weight of 144.26 g/mol, XLogP of 3.04, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexanal;methane is sourced from PubChem (CID 139299505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).