About 2-ethylhexanal;phosphane
2-ethylhexanal;phosphane (PubChem CID 174518467) has the molecular formula C8H19OP
and a molecular weight of 162.21 g/mol. Its IUPAC name is 2-ethylhexanal;phosphane.
Molecular Properties
| Compound Name | 2-ethylhexanal;phosphane |
| PubChem CID | 174518467 |
| Molecular Formula | C8H19OP |
| Molecular Weight | 162.21 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 2-ethylhexanal;phosphane |
| SMILES | CCCCC(C=O)CC.P |
| InChI | InChI=1S/C8H16O.H3P/c1-3-5-6-8(4-2)7-9;/h7-8H,3-6H2,1-2H3;1H3 |
| InChIKey | VSMWFJQQPGIOPU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.21 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylhexanal;phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexanal;phosphane?
The IUPAC name of 2-ethylhexanal;phosphane (CID 174518467) is 2-ethylhexanal;phosphane.
What is the SMILES notation for 2-ethylhexanal;phosphane?
The canonical SMILES for 2-ethylhexanal;phosphane is CCCCC(C=O)CC.P.
What is the InChIKey of 2-ethylhexanal;phosphane?
The InChIKey is VSMWFJQQPGIOPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O.H3P/c1-3-5-6-8(4-2)7-9;/h7-8H,3-6H2,1-2H3;1H3.
What are the key properties of 2-ethylhexanal;phosphane?
2-ethylhexanal;phosphane has a molecular weight of 162.21 g/mol, XLogP of 2.46, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexanal;phosphane is sourced from PubChem (CID 174518467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).