About 3-ethylhex-4-en-1-amine
3-ethylhex-4-en-1-amine (PubChem CID 123888745) has the molecular formula C8H17N
and a molecular weight of 127.23 g/mol. Its IUPAC name is 3-ethylhex-4-en-1-amine.
Molecular Properties
| Compound Name | 3-ethylhex-4-en-1-amine |
| PubChem CID | 123888745 |
| Molecular Formula | C8H17N |
| Molecular Weight | 127.23 g/mol |
| Exact Mass | 127.14 |
| IUPAC Name | 3-ethylhex-4-en-1-amine |
| SMILES | CC=CC(CC)CCN |
| InChI | InChI=1S/C8H17N/c1-3-5-8(4-2)6-7-9/h3,5,8H,4,6-7,9H2,1-2H3 |
| InChIKey | VBWRAXNKBOYHQR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.23 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-ethylhex-4-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylhex-4-en-1-amine?
The IUPAC name of 3-ethylhex-4-en-1-amine (CID 123888745) is 3-ethylhex-4-en-1-amine.
What is the SMILES notation for 3-ethylhex-4-en-1-amine?
The canonical SMILES for 3-ethylhex-4-en-1-amine is CC=CC(CC)CCN.
What is the InChIKey of 3-ethylhex-4-en-1-amine?
The InChIKey is VBWRAXNKBOYHQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N/c1-3-5-8(4-2)6-7-9/h3,5,8H,4,6-7,9H2,1-2H3.
What are the key properties of 3-ethylhex-4-en-1-amine?
3-ethylhex-4-en-1-amine has a molecular weight of 127.23 g/mol, XLogP of 1.94, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylhex-4-en-1-amine is sourced from PubChem (CID 123888745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).