C7H15N — CID 89073928
(Z,4R)-hept-2-en-4-amine (PubChem CID 89073928) has the molecular formula C7H15N and a molecular weight of 113.20 g/mol. Its IUPAC name is (Z,4R)-hept-2-en-4-amine.
| Compound Name | (Z,4R)-hept-2-en-4-amine |
|---|---|
| PubChem CID | 89073928 |
| Molecular Formula | C7H15N |
| Molecular Weight | 113.20 g/mol |
| Exact Mass | 113.12 |
| IUPAC Name | (Z,4R)-hept-2-en-4-amine |
| SMILES | C/C=C\[C@H](N)CCC |
| InChI | InChI=1S/C7H15N/c1-3-5-7(8)6-4-2/h3,5,7H,4,6,8H2,1-2H3/b5-3-/t7-/m0/s1 |
| InChIKey | NKTOFUYNQFHPDF-GLCRXLCDSA-N |
| XLogP | 1.69 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.20 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|