C11H24 — CID 158370601
methane;(E,4R)-4-propan-2-ylhept-2-ene (PubChem CID 158370601) has the molecular formula C11H24 and a molecular weight of 156.31 g/mol. Its IUPAC name is methane;(E,4R)-4-propan-2-ylhept-2-ene.
| Compound Name | methane;(E,4R)-4-propan-2-ylhept-2-ene |
|---|---|
| PubChem CID | 158370601 |
| Molecular Formula | C11H24 |
| Molecular Weight | 156.31 g/mol |
| Exact Mass | 156.19 |
| IUPAC Name | methane;(E,4R)-4-propan-2-ylhept-2-ene |
| SMILES | C.C/C=C/C(CCC)C(C)C |
| InChI | InChI=1S/C10H20.CH4/c1-5-7-10(8-6-2)9(3)4;/h5,7,9-10H,6,8H2,1-4H3;1H4/b7-5+; |
| InChIKey | GUOGXPNWZZCEDD-GZOLSCHFSA-N |
| XLogP | 4.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.31 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|