C11H20O — CID 166881675
(Z,5R)-5-propan-2-yloct-6-en-2-one (PubChem CID 166881675) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is (Z,5R)-5-propan-2-yloct-6-en-2-one.
| Compound Name | (Z,5R)-5-propan-2-yloct-6-en-2-one |
|---|---|
| PubChem CID | 166881675 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | (Z,5R)-5-propan-2-yloct-6-en-2-one |
| SMILES | C/C=C\C(CCC(C)=O)C(C)C |
| InChI | InChI=1S/C11H20O/c1-5-6-11(9(2)3)8-7-10(4)12/h5-6,9,11H,7-8H2,1-4H3/b6-5- |
| InChIKey | YULWYIPKXMGZAY-WAYWQWQTSA-N |
| XLogP | 3.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|