C20H36O4 — CID 135390797
(5S,6E,8R,10R,11E)-8,10,15-trihydroxy-8,12-dimethyl-5-propan-2-ylpentadeca-6,11-dien-2-one (PubChem CID 135390797) has the molecular formula C20H36O4 and a molecular weight of 340.50 g/mol. Its IUPAC name is (5S,6E,8R,10R,11E)-8,10,15-trihydroxy-8,12-dimethyl-5-propan-2-ylpentadeca-6,11-dien-2-one.
| Compound Name | (5S,6E,8R,10R,11E)-8,10,15-trihydroxy-8,12-dimethyl-5-propan-2-ylpentadeca-6,11-dien-2-one |
|---|---|
| PubChem CID | 135390797 |
| Molecular Formula | C20H36O4 |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | (5S,6E,8R,10R,11E)-8,10,15-trihydroxy-8,12-dimethyl-5-propan-2-ylpentadeca-6,11-dien-2-one |
| SMILES | CC(=O)CC[C@H](/C=C/[C@](C)(O)C[C@@H](O)/C=C(\C)CCCO)C(C)C |
| InChI | InChI=1S/C20H36O4/c1-15(2)18(9-8-17(4)22)10-11-20(5,24)14-19(23)13-16(3)7-6-12-21/h10-11,13,15,18-19,21,23-24H,6-9,12,14H2,1-5H3/b11-10+,16-13+/t18-,19+,20+/m1/s1 |
| InChIKey | VRYMYLAUIROARJ-RKCAUDIISA-N |
| XLogP | 3.40 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|