C15H26O3 — CID 162965161
(3R,5R,6E,10R)-3,7,11-trimethyldodeca-1,6,11-triene-3,5,10-triol (PubChem CID 162965161) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (3R,5R,6E,10R)-3,7,11-trimethyldodeca-1,6,11-triene-3,5,10-triol.
| Compound Name | (3R,5R,6E,10R)-3,7,11-trimethyldodeca-1,6,11-triene-3,5,10-triol |
|---|---|
| PubChem CID | 162965161 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (3R,5R,6E,10R)-3,7,11-trimethyldodeca-1,6,11-triene-3,5,10-triol |
| SMILES | C=C[C@](C)(O)C[C@@H](O)/C=C(\C)CC[C@@H](O)C(=C)C |
| InChI | InChI=1S/C15H26O3/c1-6-15(5,18)10-13(16)9-12(4)7-8-14(17)11(2)3/h6,9,13-14,16-18H,1-2,7-8,10H2,3-5H3/b12-9+/t13-,14+,15-/m0/s1 |
| InChIKey | UUUBEBQXNXKPPJ-WQXAFCNFSA-N |
| XLogP | 2.34 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|