C10H16O — CID 534462
2-methyl-6-methylideneocta-1,7-dien-3-ol (PubChem CID 534462) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is 2-methyl-6-methylideneocta-1,7-dien-3-ol.
| Compound Name | 2-methyl-6-methylideneocta-1,7-dien-3-ol |
|---|---|
| PubChem CID | 534462 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | 2-methyl-6-methylideneocta-1,7-dien-3-ol |
| SMILES | C=CC(=C)CCC(O)C(=C)C |
| InChI | InChI=1S/C10H16O/c1-5-9(4)6-7-10(11)8(2)3/h5,10-11H,1-2,4,6-7H2,3H3 |
| InChIKey | SQRIUUSIOSHZFA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|