C10H16O — CID 162867192
(3R)-2,6-dimethylocta-1,5,7-trien-3-ol (PubChem CID 162867192) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is (3R)-2,6-dimethylocta-1,5,7-trien-3-ol.
| Compound Name | (3R)-2,6-dimethylocta-1,5,7-trien-3-ol |
|---|---|
| PubChem CID | 162867192 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | (3R)-2,6-dimethylocta-1,5,7-trien-3-ol |
| SMILES | C=CC(C)=CC[C@@H](O)C(=C)C |
| InChI | InChI=1S/C10H16O/c1-5-9(4)6-7-10(11)8(2)3/h5-6,10-11H,1-2,7H2,3-4H3/t10-/m1/s1 |
| InChIKey | TYDDWHVJHGIJCW-SNVBAGLBSA-N |
| XLogP | 2.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|