C10H16O2 — CID 123615369
(3E)-6-hydroxy-3,7-dimethylocta-3,7-dienal (PubChem CID 123615369) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is (3E)-6-hydroxy-3,7-dimethylocta-3,7-dienal.
| Compound Name | (3E)-6-hydroxy-3,7-dimethylocta-3,7-dienal |
|---|---|
| PubChem CID | 123615369 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (3E)-6-hydroxy-3,7-dimethylocta-3,7-dienal |
| SMILES | C=C(C)C(O)C/C=C(\C)CC=O |
| InChI | InChI=1S/C10H16O2/c1-8(2)10(12)5-4-9(3)6-7-11/h4,7,10,12H,1,5-6H2,2-3H3/b9-4+ |
| InChIKey | KHOIKIRPVKXKRD-RUDMXATFSA-N |
| XLogP | 1.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|