C10H15FO — CID 24974009
(3E,7Z)-8-fluoro-3,7-dimethylocta-3,7-dienal (PubChem CID 24974009) has the molecular formula C10H15FO and a molecular weight of 170.23 g/mol. Its IUPAC name is (3E,7Z)-8-fluoro-3,7-dimethylocta-3,7-dienal.
| Compound Name | (3E,7Z)-8-fluoro-3,7-dimethylocta-3,7-dienal |
|---|---|
| PubChem CID | 24974009 |
| Molecular Formula | C10H15FO |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | (3E,7Z)-8-fluoro-3,7-dimethylocta-3,7-dienal |
| SMILES | C/C(=C/F)CC/C=C(\C)CC=O |
| InChI | InChI=1S/C10H15FO/c1-9(6-7-12)4-3-5-10(2)8-11/h4,7-8H,3,5-6H2,1-2H3/b9-4+,10-8- |
| InChIKey | GIJBXIZYDRBRSY-HMOYTYQUSA-N |
| XLogP | 3.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|