C15H24O2 — CID 71381085
4,8-dimethyl-12-oxotrideca-4,8-dienal (PubChem CID 71381085) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is 4,8-dimethyl-12-oxotrideca-4,8-dienal.
| Compound Name | 4,8-dimethyl-12-oxotrideca-4,8-dienal |
|---|---|
| PubChem CID | 71381085 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 4,8-dimethyl-12-oxotrideca-4,8-dienal |
| SMILES | CC(=O)CCC=C(C)CCC=C(C)CCC=O |
| InChI | InChI=1S/C15H24O2/c1-13(9-5-11-15(3)17)7-4-8-14(2)10-6-12-16/h8-9,12H,4-7,10-11H2,1-3H3 |
| InChIKey | WFSIQNRAWDRWLN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|