C28H45NO2 — CID 15069733
(2E,6E,10E,14E,18E)-2,6,10,14,18-pentamethyl-22-oxotricosa-2,6,10,14,18-pentaenamide (PubChem CID 15069733) has the molecular formula C28H45NO2 and a molecular weight of 427.67 g/mol. Its IUPAC name is (2E,6E,10E,14E,18E)-2,6,10,14,18-pentamethyl-22-oxotricosa-2,6,10,14,18-pentaenamide.
| Compound Name | (2E,6E,10E,14E,18E)-2,6,10,14,18-pentamethyl-22-oxotricosa-2,6,10,14,18-pentaenamide |
|---|---|
| PubChem CID | 15069733 |
| Molecular Formula | C28H45NO2 |
| Molecular Weight | 427.67 g/mol |
| Exact Mass | 427.35 |
| IUPAC Name | (2E,6E,10E,14E,18E)-2,6,10,14,18-pentamethyl-22-oxotricosa-2,6,10,14,18-pentaenamide |
| SMILES | CC(=O)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)C(N)=O |
| InChI | InChI=1S/C28H45NO2/c1-22(14-8-16-24(3)18-10-20-26(5)28(29)31)12-7-13-23(2)15-9-17-25(4)19-11-21-27(6)30/h12,15-16,19-20H,7-11,13-14,17-18,21H2,1-6H3,(H2,29,31)/b22-12+,23-15+,24-16+,25-19+,26-20+ |
| InChIKey | XYWZSNQNVNHQDY-MOWBPGKPSA-N |
| XLogP | 7.69 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.67 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|