C26H45NO2 — CID 54407553
2,6,10-trimethyl-N,N-bis(2-methylpropyl)-14-oxopentadeca-2,6,10-trienamide (PubChem CID 54407553) has the molecular formula C26H45NO2 and a molecular weight of 403.65 g/mol. Its IUPAC name is 2,6,10-trimethyl-N,N-bis(2-methylpropyl)-14-oxopentadeca-2,6,10-trienamide.
| Compound Name | 2,6,10-trimethyl-N,N-bis(2-methylpropyl)-14-oxopentadeca-2,6,10-trienamide |
|---|---|
| PubChem CID | 54407553 |
| Molecular Formula | C26H45NO2 |
| Molecular Weight | 403.65 g/mol |
| Exact Mass | 403.35 |
| IUPAC Name | 2,6,10-trimethyl-N,N-bis(2-methylpropyl)-14-oxopentadeca-2,6,10-trienamide |
| SMILES | CC(=O)CCC=C(C)CCC=C(C)CCC=C(C)C(=O)N(CC(C)C)CC(C)C |
| InChI | InChI=1S/C26H45NO2/c1-20(2)18-27(19-21(3)4)26(29)24(7)16-10-14-22(5)12-9-13-23(6)15-11-17-25(8)28/h12,15-16,20-21H,9-11,13-14,17-19H2,1-8H3 |
| InChIKey | VRUFNRRURFZKAB-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.65 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|