C13H20O2 — CID 87827115
(2E,6E)-2,6-dimethyl-10-oxoundeca-2,6-dienal (PubChem CID 87827115) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is (2E,6E)-2,6-dimethyl-10-oxoundeca-2,6-dienal.
| Compound Name | (2E,6E)-2,6-dimethyl-10-oxoundeca-2,6-dienal |
|---|---|
| PubChem CID | 87827115 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | (2E,6E)-2,6-dimethyl-10-oxoundeca-2,6-dienal |
| SMILES | CC(=O)CC/C=C(\C)CC/C=C(\C)C=O |
| InChI | InChI=1S/C13H20O2/c1-11(7-5-9-13(3)15)6-4-8-12(2)10-14/h7-8,10H,4-6,9H2,1-3H3/b11-7+,12-8+ |
| InChIKey | UWMWUSQDDKGWQU-MKICQXMISA-N |
| XLogP | 3.23 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|