C20H28O4S — CID 142689055
2,6,11,15-tetramethyl-8-sulfonylhexadeca-2,6,10,14-tetraenedial (PubChem CID 142689055) has the molecular formula C20H28O4S and a molecular weight of 364.51 g/mol. Its IUPAC name is 2,6,11,15-tetramethyl-8-sulfonylhexadeca-2,6,10,14-tetraenedial.
| Compound Name | 2,6,11,15-tetramethyl-8-sulfonylhexadeca-2,6,10,14-tetraenedial |
|---|---|
| PubChem CID | 142689055 |
| Molecular Formula | C20H28O4S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 2,6,11,15-tetramethyl-8-sulfonylhexadeca-2,6,10,14-tetraenedial |
| SMILES | CC(C=O)=CCCC(C)=CCC(C=C(C)CCC=C(C)C=O)=S(=O)=O |
| InChI | InChI=1S/C20H28O4S/c1-16(7-5-9-18(3)14-21)11-12-20(25(23)24)13-17(2)8-6-10-19(4)15-22/h9-11,13-15H,5-8,12H2,1-4H3 |
| InChIKey | JWCVJUPLNWEBAS-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|