C25H36O5 — CID 85417904
3-methyl-4-oxo-4-(3,7,11,15-tetramethyl-16-oxohexadeca-2,6,10,14-tetraenoxy)but-2-enoic acid (PubChem CID 85417904) has the molecular formula C25H36O5 and a molecular weight of 416.56 g/mol. Its IUPAC name is 3-methyl-4-oxo-4-(3,7,11,15-tetramethyl-16-oxohexadeca-2,6,10,14-tetraenoxy)but-2-enoic acid.
| Compound Name | 3-methyl-4-oxo-4-(3,7,11,15-tetramethyl-16-oxohexadeca-2,6,10,14-tetraenoxy)but-2-enoic acid |
|---|---|
| PubChem CID | 85417904 |
| Molecular Formula | C25H36O5 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | 3-methyl-4-oxo-4-(3,7,11,15-tetramethyl-16-oxohexadeca-2,6,10,14-tetraenoxy)but-2-enoic acid |
| SMILES | CC(C=O)=CCCC(C)=CCCC(C)=CCCC(C)=CCOC(=O)C(C)=CC(=O)O |
| InChI | InChI=1S/C25H36O5/c1-19(9-6-10-20(2)12-8-14-22(4)18-26)11-7-13-21(3)15-16-30-25(29)23(5)17-24(27)28/h10-11,14-15,17-18H,6-9,12-13,16H2,1-5H3,(H,27,28) |
| InChIKey | AOJDLUWCHJXNCH-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|