C10H16O — CID 19035325
(2E,6E)-2,6-dimethylocta-2,6-dienal (PubChem CID 19035325) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is (2E,6E)-2,6-dimethylocta-2,6-dienal.
| Compound Name | (2E,6E)-2,6-dimethylocta-2,6-dienal |
|---|---|
| PubChem CID | 19035325 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | (2E,6E)-2,6-dimethylocta-2,6-dienal |
| SMILES | C/C=C(\C)CC/C=C(\C)C=O |
| InChI | InChI=1S/C10H16O/c1-4-9(2)6-5-7-10(3)8-11/h4,7-8H,5-6H2,1-3H3/b9-4+,10-7+ |
| InChIKey | HVVPDZLBSPUSGE-SXFWLWNESA-N |
| XLogP | 2.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|