C10H14Cl2O — CID 14865331
(2E,6Z)-8-chloro-6-(chloromethyl)-2-methylocta-2,6-dienal (PubChem CID 14865331) has the molecular formula C10H14Cl2O and a molecular weight of 221.13 g/mol. Its IUPAC name is (2E,6Z)-8-chloro-6-(chloromethyl)-2-methylocta-2,6-dienal.
| Compound Name | (2E,6Z)-8-chloro-6-(chloromethyl)-2-methylocta-2,6-dienal |
|---|---|
| PubChem CID | 14865331 |
| Molecular Formula | C10H14Cl2O |
| Molecular Weight | 221.13 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | (2E,6Z)-8-chloro-6-(chloromethyl)-2-methylocta-2,6-dienal |
| SMILES | C/C(C=O)=C\CC/C(=C/CCl)CCl |
| InChI | InChI=1S/C10H14Cl2O/c1-9(8-13)3-2-4-10(7-12)5-6-11/h3,5,8H,2,4,6-7H2,1H3/b9-3+,10-5- |
| InChIKey | JQUUTSBSWFKCKS-AWTZEJBTSA-N |
| XLogP | 3.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.13 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|