About 3-bromo-8-chloro-6-(chloromethyl)-2-methylocta-1,6-diene
3-bromo-8-chloro-6-(chloromethyl)-2-methylocta-1,6-diene (PubChem CID 72732358) has the molecular formula C10H15BrCl2
and a molecular weight of 286.04 g/mol. Its IUPAC name is 3-bromo-8-chloro-6-(chloromethyl)-2-methylocta-1,6-diene.
Molecular Properties
| Compound Name | 3-bromo-8-chloro-6-(chloromethyl)-2-methylocta-1,6-diene |
| PubChem CID | 72732358 |
| Molecular Formula | C10H15BrCl2 |
| Molecular Weight | 286.04 g/mol |
| Exact Mass | 283.97 |
| IUPAC Name | 3-bromo-8-chloro-6-(chloromethyl)-2-methylocta-1,6-diene |
| SMILES | C=C(C)C(Br)CCC(=CCCl)CCl |
| InChI | InChI=1S/C10H15BrCl2/c1-8(2)10(11)4-3-9(7-13)5-6-12/h5,10H,1,3-4,6-7H2,2H3 |
| InChIKey | ZFONOJWQZANXOP-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.04 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-8-chloro-6-(chloromethyl)-2-methylocta-1,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-8-chloro-6-(chloromethyl)-2-methylocta-1,6-diene?
The IUPAC name of 3-bromo-8-chloro-6-(chloromethyl)-2-methylocta-1,6-diene (CID 72732358) is 3-bromo-8-chloro-6-(chloromethyl)-2-methylocta-1,6-diene.
What is the SMILES notation for 3-bromo-8-chloro-6-(chloromethyl)-2-methylocta-1,6-diene?
The canonical SMILES for 3-bromo-8-chloro-6-(chloromethyl)-2-methylocta-1,6-diene is C=C(C)C(Br)CCC(=CCCl)CCl.
What is the InChIKey of 3-bromo-8-chloro-6-(chloromethyl)-2-methylocta-1,6-diene?
The InChIKey is ZFONOJWQZANXOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15BrCl2/c1-8(2)10(11)4-3-9(7-13)5-6-12/h5,10H,1,3-4,6-7H2,2H3.
What are the key properties of 3-bromo-8-chloro-6-(chloromethyl)-2-methylocta-1,6-diene?
3-bromo-8-chloro-6-(chloromethyl)-2-methylocta-1,6-diene has a molecular weight of 286.04 g/mol, XLogP of 4.51, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-8-chloro-6-(chloromethyl)-2-methylocta-1,6-diene is sourced from PubChem (CID 72732358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).