About (Z)-6-bromo-1,7-dichloro-3-(chloromethyl)-7-methyloct-2-ene
(Z)-6-bromo-1,7-dichloro-3-(chloromethyl)-7-methyloct-2-ene (PubChem CID 14865330) has the molecular formula C10H16BrCl3
and a molecular weight of 322.50 g/mol. Its IUPAC name is (Z)-6-bromo-1,7-dichloro-3-(chloromethyl)-7-methyloct-2-ene.
Molecular Properties
| Compound Name | (Z)-6-bromo-1,7-dichloro-3-(chloromethyl)-7-methyloct-2-ene |
| PubChem CID | 14865330 |
| Molecular Formula | C10H16BrCl3 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 319.95 |
| IUPAC Name | (Z)-6-bromo-1,7-dichloro-3-(chloromethyl)-7-methyloct-2-ene |
| SMILES | CC(C)(Cl)C(Br)CC/C(=C/CCl)CCl |
| InChI | InChI=1S/C10H16BrCl3/c1-10(2,14)9(11)4-3-8(7-13)5-6-12/h5,9H,3-4,6-7H2,1-2H3/b8-5- |
| InChIKey | LAPBUZYJFWQRTR-YVMONPNESA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-6-bromo-1,7-dichloro-3-(chloromethyl)-7-methyloct-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-6-bromo-1,7-dichloro-3-(chloromethyl)-7-methyloct-2-ene?
The IUPAC name of (Z)-6-bromo-1,7-dichloro-3-(chloromethyl)-7-methyloct-2-ene (CID 14865330) is (Z)-6-bromo-1,7-dichloro-3-(chloromethyl)-7-methyloct-2-ene.
What is the SMILES notation for (Z)-6-bromo-1,7-dichloro-3-(chloromethyl)-7-methyloct-2-ene?
The canonical SMILES for (Z)-6-bromo-1,7-dichloro-3-(chloromethyl)-7-methyloct-2-ene is CC(C)(Cl)C(Br)CC/C(=C/CCl)CCl.
What is the InChIKey of (Z)-6-bromo-1,7-dichloro-3-(chloromethyl)-7-methyloct-2-ene?
The InChIKey is LAPBUZYJFWQRTR-YVMONPNESA-N. The full InChI is InChI=1S/C10H16BrCl3/c1-10(2,14)9(11)4-3-8(7-13)5-6-12/h5,9H,3-4,6-7H2,1-2H3/b8-5-.
What are the key properties of (Z)-6-bromo-1,7-dichloro-3-(chloromethyl)-7-methyloct-2-ene?
(Z)-6-bromo-1,7-dichloro-3-(chloromethyl)-7-methyloct-2-ene has a molecular weight of 322.50 g/mol, XLogP of 4.95, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-6-bromo-1,7-dichloro-3-(chloromethyl)-7-methyloct-2-ene is sourced from PubChem (CID 14865330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).