C10H16BrCl3 — CID 14865330
(Z)-6-bromo-1,7-dichloro-3-(chloromethyl)-7-methyloct-2-ene (PubChem CID 14865330) has the molecular formula C10H16BrCl3 and a molecular weight of 322.50 g/mol. Its IUPAC name is (Z)-6-bromo-1,7-dichloro-3-(chloromethyl)-7-methyloct-2-ene.
| Compound Name | (Z)-6-bromo-1,7-dichloro-3-(chloromethyl)-7-methyloct-2-ene |
|---|---|
| PubChem CID | 14865330 |
| Molecular Formula | C10H16BrCl3 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 319.95 |
| IUPAC Name | (Z)-6-bromo-1,7-dichloro-3-(chloromethyl)-7-methyloct-2-ene |
| SMILES | CC(C)(Cl)C(Br)CC/C(=C/CCl)CCl |
| InChI | InChI=1S/C10H16BrCl3/c1-10(2,14)9(11)4-3-8(7-13)5-6-12/h5,9H,3-4,6-7H2,1-2H3/b8-5- |
| InChIKey | LAPBUZYJFWQRTR-YVMONPNESA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|