C11H19ClO2 — CID 72740292
6-(chloromethyl)-8-methoxy-2-methylocta-1,6-dien-3-ol (PubChem CID 72740292) has the molecular formula C11H19ClO2 and a molecular weight of 218.72 g/mol. Its IUPAC name is 6-(chloromethyl)-8-methoxy-2-methylocta-1,6-dien-3-ol.
| Compound Name | 6-(chloromethyl)-8-methoxy-2-methylocta-1,6-dien-3-ol |
|---|---|
| PubChem CID | 72740292 |
| Molecular Formula | C11H19ClO2 |
| Molecular Weight | 218.72 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 6-(chloromethyl)-8-methoxy-2-methylocta-1,6-dien-3-ol |
| SMILES | C=C(C)C(O)CCC(=CCOC)CCl |
| InChI | InChI=1S/C11H19ClO2/c1-9(2)11(13)5-4-10(8-12)6-7-14-3/h6,11,13H,1,4-5,7-8H2,2-3H3 |
| InChIKey | ORTLPYMSRXBBBT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.72 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|