C8H16O2 — CID 146216379
(Z)-1,5-dimethoxy-3-methylpent-2-ene (PubChem CID 146216379) has the molecular formula C8H16O2 and a molecular weight of 144.21 g/mol. Its IUPAC name is (Z)-1,5-dimethoxy-3-methylpent-2-ene.
| Compound Name | (Z)-1,5-dimethoxy-3-methylpent-2-ene |
|---|---|
| PubChem CID | 146216379 |
| Molecular Formula | C8H16O2 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.12 |
| IUPAC Name | (Z)-1,5-dimethoxy-3-methylpent-2-ene |
| SMILES | COC/C=C(/C)CCOC |
| InChI | InChI=1S/C8H16O2/c1-8(4-6-9-2)5-7-10-3/h4H,5-7H2,1-3H3/b8-4- |
| InChIKey | WISQIEKPJXHWFJ-YWEYNIOJSA-N |
| XLogP | 1.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|