[(E)-6-(methoxymethoxy)-3-methylhex-2-enyl] phosphono hydrogen phosphate

C9H20O9P2 — CID 11099683

IUPAC[(E)-6-(methoxymethoxy)-3-methylhex-2-enyl] phosphono hydrogen phosphate
SMILESCOCOCCC/C(C)=C/COP(=O)(O)OP(=O)(O)O
InChIInChI=1S/C9H20O9P2/c1-9(4-3-6-16-8-15-2)5-7-17-20(13,14)18-19(10,11)12/h5H,3-4,6-8H2,1-2H3,(H,13,14)(H2,10,11,12)/b9-5+
InChIKeyAIAIXAISEDWLFS-WEVVVXLNSA-N
MW334.20 g/mol
LogP1.56
Rot. Bonds11

About [(E)-6-(methoxymethoxy)-3-methylhex-2-enyl] phosphono hydrogen phosphate

[(E)-6-(methoxymethoxy)-3-methylhex-2-enyl] phosphono hydrogen phosphate (PubChem CID 11099683) has the molecular formula C9H20O9P2 and a molecular weight of 334.20 g/mol. Its IUPAC name is [(E)-6-(methoxymethoxy)-3-methylhex-2-enyl] phosphono hydrogen phosphate.

Molecular Properties

Compound Name[(E)-6-(methoxymethoxy)-3-methylhex-2-enyl] phosphono hydrogen phosphate
PubChem CID11099683
Molecular FormulaC9H20O9P2
Molecular Weight334.20 g/mol
Exact Mass334.06
IUPAC Name[(E)-6-(methoxymethoxy)-3-methylhex-2-enyl] phosphono hydrogen phosphate
SMILESCOCOCCC/C(C)=C/COP(=O)(O)OP(=O)(O)O
InChIInChI=1S/C9H20O9P2/c1-9(4-3-6-16-8-15-2)5-7-17-20(13,14)18-19(10,11)12/h5H,3-4,6-8H2,1-2H3,(H,13,14)(H2,10,11,12)/b9-5+
InChIKeyAIAIXAISEDWLFS-WEVVVXLNSA-N
XLogP1.56
TPSA131.75 Ų
H-Bond Donors3
H-Bond Acceptors6
Rotatable Bonds11
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500334.20
LogP ≤ 51.56
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze [(E)-6-(methoxymethoxy)-3-methylhex-2-enyl] phosphono hydrogen phosphate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(E)-6-(methoxymethoxy)-3-methylhex-2-enyl] phosphono hydrogen phosphate?
The IUPAC name of [(E)-6-(methoxymethoxy)-3-methylhex-2-enyl] phosphono hydrogen phosphate (CID 11099683) is [(E)-6-(methoxymethoxy)-3-methylhex-2-enyl] phosphono hydrogen phosphate.
What is the SMILES notation for [(E)-6-(methoxymethoxy)-3-methylhex-2-enyl] phosphono hydrogen phosphate?
The canonical SMILES for [(E)-6-(methoxymethoxy)-3-methylhex-2-enyl] phosphono hydrogen phosphate is COCOCCC/C(C)=C/COP(=O)(O)OP(=O)(O)O.
What is the InChIKey of [(E)-6-(methoxymethoxy)-3-methylhex-2-enyl] phosphono hydrogen phosphate?
The InChIKey is AIAIXAISEDWLFS-WEVVVXLNSA-N. The full InChI is InChI=1S/C9H20O9P2/c1-9(4-3-6-16-8-15-2)5-7-17-20(13,14)18-19(10,11)12/h5H,3-4,6-8H2,1-2H3,(H,13,14)(H2,10,11,12)/b9-5+.
What are the key properties of [(E)-6-(methoxymethoxy)-3-methylhex-2-enyl] phosphono hydrogen phosphate?
[(E)-6-(methoxymethoxy)-3-methylhex-2-enyl] phosphono hydrogen phosphate has a molecular weight of 334.20 g/mol, XLogP of 1.56, 11 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-6-(methoxymethoxy)-3-methylhex-2-enyl] phosphono hydrogen phosphate is sourced from PubChem (CID 11099683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).