C9H20O9P2 — CID 11099683
[(E)-6-(methoxymethoxy)-3-methylhex-2-enyl] phosphono hydrogen phosphate (PubChem CID 11099683) has the molecular formula C9H20O9P2 and a molecular weight of 334.20 g/mol. Its IUPAC name is [(E)-6-(methoxymethoxy)-3-methylhex-2-enyl] phosphono hydrogen phosphate.
| Compound Name | [(E)-6-(methoxymethoxy)-3-methylhex-2-enyl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 11099683 |
| Molecular Formula | C9H20O9P2 |
| Molecular Weight | 334.20 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | [(E)-6-(methoxymethoxy)-3-methylhex-2-enyl] phosphono hydrogen phosphate |
| SMILES | COCOCCC/C(C)=C/COP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C9H20O9P2/c1-9(4-3-6-16-8-15-2)5-7-17-20(13,14)18-19(10,11)12/h5H,3-4,6-8H2,1-2H3,(H,13,14)(H2,10,11,12)/b9-5+ |
| InChIKey | AIAIXAISEDWLFS-WEVVVXLNSA-N |
| XLogP | 1.56 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.20 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|