C5H12O7P2S — CID 70680577
[(E)-3-methyl-4-sulfanylbut-2-enyl] phosphono hydrogen phosphate (PubChem CID 70680577) has the molecular formula C5H12O7P2S and a molecular weight of 278.16 g/mol. Its IUPAC name is [(E)-3-methyl-4-sulfanylbut-2-enyl] phosphono hydrogen phosphate.
| Compound Name | [(E)-3-methyl-4-sulfanylbut-2-enyl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 70680577 |
| Molecular Formula | C5H12O7P2S |
| Molecular Weight | 278.16 g/mol |
| Exact Mass | 277.98 |
| IUPAC Name | [(E)-3-methyl-4-sulfanylbut-2-enyl] phosphono hydrogen phosphate |
| SMILES | C/C(=C\COP(=O)(O)OP(=O)(O)O)CS |
| InChI | InChI=1S/C5H12O7P2S/c1-5(4-15)2-3-11-14(9,10)12-13(6,7)8/h2,15H,3-4H2,1H3,(H,9,10)(H2,6,7,8)/b5-2+ |
| InChIKey | YSUKJHNOIKPIFM-GORDUTHDSA-N |
| XLogP | 1.09 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.16 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|